C16H13F3O5 — CID 156779547
5-[[4-prop-2-enyl-2-(trifluoromethoxy)phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 156779547) has the molecular formula C16H13F3O5 and a molecular weight of 342.27 g/mol. Its IUPAC name is 5-[[4-prop-2-enyl-2-(trifluoromethoxy)phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-prop-2-enyl-2-(trifluoromethoxy)phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 156779547 |
| Molecular Formula | C16H13F3O5 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 5-[[4-prop-2-enyl-2-(trifluoromethoxy)phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | C=CCc1ccc(OCc2ccc(C(=O)O)o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3O5/c1-2-3-10-4-6-12(14(8-10)24-16(17,18)19)22-9-11-5-7-13(23-11)15(20)21/h2,4-8H,1,3,9H2,(H,20,21) |
| InChIKey | QYKLXVZRRABQGR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|