C16H17BrO4 — CID 20993310
5-[(2-bromo-4-tert-butylphenoxy)methyl]furan-2-carboxylic acid (PubChem CID 20993310) has the molecular formula C16H17BrO4 and a molecular weight of 353.21 g/mol. Its IUPAC name is 5-[(2-bromo-4-tert-butylphenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-bromo-4-tert-butylphenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 20993310 |
| Molecular Formula | C16H17BrO4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 5-[(2-bromo-4-tert-butylphenoxy)methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)O)o2)c(Br)c1 |
| InChI | InChI=1S/C16H17BrO4/c1-16(2,3)10-4-6-13(12(17)8-10)20-9-11-5-7-14(21-11)15(18)19/h4-8H,9H2,1-3H3,(H,18,19) |
| InChIKey | BFPBESXGOFWORT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |