C18H21BrO4 — CID 22684980
5-[(2-bromo-6-tert-butyl-4-ethylphenoxy)methyl]furan-2-carboxylic acid (PubChem CID 22684980) has the molecular formula C18H21BrO4 and a molecular weight of 381.27 g/mol. Its IUPAC name is 5-[(2-bromo-6-tert-butyl-4-ethylphenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-bromo-6-tert-butyl-4-ethylphenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 22684980 |
| Molecular Formula | C18H21BrO4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-[(2-bromo-6-tert-butyl-4-ethylphenoxy)methyl]furan-2-carboxylic acid |
| SMILES | CCc1cc(Br)c(OCc2ccc(C(=O)O)o2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H21BrO4/c1-5-11-8-13(18(2,3)4)16(14(19)9-11)22-10-12-6-7-15(23-12)17(20)21/h6-9H,5,10H2,1-4H3,(H,20,21) |
| InChIKey | DIQHBKWTRIBBSS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |