C12H6Br3O4- — CID 7138860
5-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylate (PubChem CID 7138860) has the molecular formula C12H6Br3O4- and a molecular weight of 453.89 g/mol. Its IUPAC name is 5-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylate.
| Compound Name | 5-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7138860 |
| Molecular Formula | C12H6Br3O4- |
| Molecular Weight | 453.89 g/mol |
| Exact Mass | 450.78 |
| IUPAC Name | 5-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(COc2c(Br)cc(Br)cc2Br)o1 |
| InChI | InChI=1S/C12H7Br3O4/c13-6-3-8(14)11(9(15)4-6)18-5-7-1-2-10(19-7)12(16)17/h1-4H,5H2,(H,16,17)/p-1 |
| InChIKey | VDUBVYCJYQXSPN-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |