C13H8NO4- — CID 4290764
5-[(4-cyanophenoxy)methyl]furan-2-carboxylate (PubChem CID 4290764) has the molecular formula C13H8NO4- and a molecular weight of 242.21 g/mol. Its IUPAC name is 5-[(4-cyanophenoxy)methyl]furan-2-carboxylate.
| Compound Name | 5-[(4-cyanophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4290764 |
| Molecular Formula | C13H8NO4- |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-[(4-cyanophenoxy)methyl]furan-2-carboxylate |
| SMILES | N#Cc1ccc(OCc2ccc(C(=O)[O-])o2)cc1 |
| InChI | InChI=1S/C13H9NO4/c14-7-9-1-3-10(4-2-9)17-8-11-5-6-12(18-11)13(15)16/h1-6H,8H2,(H,15,16)/p-1 |
| InChIKey | GBTXBOTVXAHUMP-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |