C25H25N3O4 — CID 86905262
4-[[5-[4-(2-hydroxy-2-phenylethyl)piperazine-1-carbonyl]furan-2-yl]methoxy]benzonitrile (PubChem CID 86905262) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-[[5-[4-(2-hydroxy-2-phenylethyl)piperazine-1-carbonyl]furan-2-yl]methoxy]benzonitrile.
| Compound Name | 4-[[5-[4-(2-hydroxy-2-phenylethyl)piperazine-1-carbonyl]furan-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 86905262 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-[[5-[4-(2-hydroxy-2-phenylethyl)piperazine-1-carbonyl]furan-2-yl]methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCc2ccc(C(=O)N3CCN(CC(O)c4ccccc4)CC3)o2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c26-16-19-6-8-21(9-7-19)31-18-22-10-11-24(32-22)25(30)28-14-12-27(13-15-28)17-23(29)20-4-2-1-3-5-20/h1-11,23,29H,12-15,17-18H2 |
| InChIKey | AJFUGUVYOXRMEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |