C16H16ClO4- — CID 7015019
5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxylate (PubChem CID 7015019) has the molecular formula C16H16ClO4- and a molecular weight of 307.75 g/mol. Its IUPAC name is 5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxylate.
| Compound Name | 5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7015019 |
| Molecular Formula | C16H16ClO4- |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxylate |
| SMILES | Cc1cc(OCc2ccc(C(=O)[O-])o2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C16H17ClO4/c1-9(2)12-7-13(17)10(3)6-15(12)20-8-11-4-5-14(21-11)16(18)19/h4-7,9H,8H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | ANUQQNCJSGEAFZ-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |