C26H32ClNO3 — CID 19580675
N-(1-adamantyl)-5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19580675) has the molecular formula C26H32ClNO3 and a molecular weight of 442.00 g/mol. Its IUPAC name is N-(1-adamantyl)-5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-adamantyl)-5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19580675 |
| Molecular Formula | C26H32ClNO3 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(1-adamantyl)-5-[(4-chloro-5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)NC34CC5CC(CC(C5)C3)C4)o2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C26H32ClNO3/c1-15(2)21-10-22(27)16(3)6-24(21)30-14-20-4-5-23(31-20)25(29)28-26-11-17-7-18(12-26)9-19(8-17)13-26/h4-6,10,15,17-19H,7-9,11-14H2,1-3H3,(H,28,29) |
| InChIKey | LAOGNQFFOIGRIZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |