C14H19NO5 — CID 58423532
prop-2-enyl 3-(4-amino-2-methoxyphenoxy)-2-hydroxy-2-methylpropanoate (PubChem CID 58423532) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is prop-2-enyl 3-(4-amino-2-methoxyphenoxy)-2-hydroxy-2-methylpropanoate.
| Compound Name | prop-2-enyl 3-(4-amino-2-methoxyphenoxy)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 58423532 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | prop-2-enyl 3-(4-amino-2-methoxyphenoxy)-2-hydroxy-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)(O)COc1ccc(N)cc1OC |
| InChI | InChI=1S/C14H19NO5/c1-4-7-19-13(16)14(2,17)9-20-11-6-5-10(15)8-12(11)18-3/h4-6,8,17H,1,7,9,15H2,2-3H3 |
| InChIKey | IBFVFVMJHQLRMZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|