C15H14F3NO5 — CID 69382888
1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid (PubChem CID 69382888) has the molecular formula C15H14F3NO5 and a molecular weight of 345.27 g/mol. Its IUPAC name is 1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid.
| Compound Name | 1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69382888 |
| Molecular Formula | C15H14F3NO5 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid |
| SMILES | C=CCOc1ccc(C(=O)N2CCC2C(=O)O)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H14F3NO5/c1-2-7-23-11-4-3-9(8-12(11)24-15(16,17)18)13(20)19-6-5-10(19)14(21)22/h2-4,8,10H,1,5-7H2,(H,21,22) |
| InChIKey | CFQPOEFLNAKTGF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|