C12H14N2O3S — CID 10355565
(2R)-N-hydroxy-1-(3-methylsulfanylbenzoyl)azetidine-2-carboxamide (PubChem CID 10355565) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is (2R)-N-hydroxy-1-(3-methylsulfanylbenzoyl)azetidine-2-carboxamide.
| Compound Name | (2R)-N-hydroxy-1-(3-methylsulfanylbenzoyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 10355565 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (2R)-N-hydroxy-1-(3-methylsulfanylbenzoyl)azetidine-2-carboxamide |
| SMILES | CSc1cccc(C(=O)N2CC[C@@H]2C(=O)NO)c1 |
| InChI | InChI=1S/C12H14N2O3S/c1-18-9-4-2-3-8(7-9)12(16)14-6-5-10(14)11(15)13-17/h2-4,7,10,17H,5-6H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | JYSPZDMQGOEJES-SNVBAGLBSA-N |
| XLogP | 1.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|