C18H27NOS2 — CID 121023048
[2-(tert-butylsulfanylmethyl)piperidin-1-yl]-(3-methylsulfanylphenyl)methanone (PubChem CID 121023048) has the molecular formula C18H27NOS2 and a molecular weight of 337.55 g/mol. Its IUPAC name is [2-(tert-butylsulfanylmethyl)piperidin-1-yl]-(3-methylsulfanylphenyl)methanone.
| Compound Name | [2-(tert-butylsulfanylmethyl)piperidin-1-yl]-(3-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 121023048 |
| Molecular Formula | C18H27NOS2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(tert-butylsulfanylmethyl)piperidin-1-yl]-(3-methylsulfanylphenyl)methanone |
| SMILES | CSc1cccc(C(=O)N2CCCCC2CSC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NOS2/c1-18(2,3)22-13-15-9-5-6-11-19(15)17(20)14-8-7-10-16(12-14)21-4/h7-8,10,12,15H,5-6,9,11,13H2,1-4H3 |
| InChIKey | ZSAVPDPFEQULRN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |