C19H29NOS — CID 119105799
1-[2-(tert-butylsulfanylmethyl)piperidin-1-yl]-2-(3-methylphenyl)ethanone (PubChem CID 119105799) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is 1-[2-(tert-butylsulfanylmethyl)piperidin-1-yl]-2-(3-methylphenyl)ethanone.
| Compound Name | 1-[2-(tert-butylsulfanylmethyl)piperidin-1-yl]-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 119105799 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-[2-(tert-butylsulfanylmethyl)piperidin-1-yl]-2-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(CC(=O)N2CCCCC2CSC(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NOS/c1-15-8-7-9-16(12-15)13-18(21)20-11-6-5-10-17(20)14-22-19(2,3)4/h7-9,12,17H,5-6,10-11,13-14H2,1-4H3 |
| InChIKey | UMCZZNHUQFEGAY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |