C20H31NOS — CID 129356966
1-[(2S)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-3-(2-methylphenyl)propan-1-one (PubChem CID 129356966) has the molecular formula C20H31NOS and a molecular weight of 333.54 g/mol. Its IUPAC name is 1-[(2S)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-3-(2-methylphenyl)propan-1-one.
| Compound Name | 1-[(2S)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-3-(2-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 129356966 |
| Molecular Formula | C20H31NOS |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-[(2S)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-3-(2-methylphenyl)propan-1-one |
| SMILES | Cc1ccccc1CCC(=O)N1CCCC[C@H]1CSC(C)(C)C |
| InChI | InChI=1S/C20H31NOS/c1-16-9-5-6-10-17(16)12-13-19(22)21-14-8-7-11-18(21)15-23-20(2,3)4/h5-6,9-10,18H,7-8,11-15H2,1-4H3/t18-/m0/s1 |
| InChIKey | KJWVHJRTJHWFGX-SFHVURJKSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |