C16H19F3N2O4S — CID 10318338
(2R)-1-[4-butoxy-3-(trifluoromethylsulfanyl)benzoyl]-N-hydroxyazetidine-2-carboxamide (PubChem CID 10318338) has the molecular formula C16H19F3N2O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is (2R)-1-[4-butoxy-3-(trifluoromethylsulfanyl)benzoyl]-N-hydroxyazetidine-2-carboxamide.
| Compound Name | (2R)-1-[4-butoxy-3-(trifluoromethylsulfanyl)benzoyl]-N-hydroxyazetidine-2-carboxamide |
|---|---|
| PubChem CID | 10318338 |
| Molecular Formula | C16H19F3N2O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2R)-1-[4-butoxy-3-(trifluoromethylsulfanyl)benzoyl]-N-hydroxyazetidine-2-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)N2CC[C@@H]2C(=O)NO)cc1SC(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O4S/c1-2-3-8-25-12-5-4-10(9-13(12)26-16(17,18)19)15(23)21-7-6-11(21)14(22)20-24/h4-5,9,11,24H,2-3,6-8H2,1H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | AQDNCWHLKRLGOJ-LLVKDONJSA-N |
| XLogP | 3.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|