C16H20BrNO2 — CID 17067207
(3-bromo-4-prop-2-enoxyphenyl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 17067207) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (3-bromo-4-prop-2-enoxyphenyl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (3-bromo-4-prop-2-enoxyphenyl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17067207 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (3-bromo-4-prop-2-enoxyphenyl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | C=CCOc1ccc(C(=O)N2CCC(C)CC2)cc1Br |
| InChI | InChI=1S/C16H20BrNO2/c1-3-10-20-15-5-4-13(11-14(15)17)16(19)18-8-6-12(2)7-9-18/h3-5,11-12H,1,6-10H2,2H3 |
| InChIKey | VCGOLCWWTPLVML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|