C18H24BrNO3 — CID 17131711
[3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 17131711) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17131711 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(OCC3CCCO3)c(Br)c2)CC1 |
| InChI | InChI=1S/C18H24BrNO3/c1-13-6-8-20(9-7-13)18(21)14-4-5-17(16(19)11-14)23-12-15-3-2-10-22-15/h4-5,11,13,15H,2-3,6-10,12H2,1H3 |
| InChIKey | ARDMKVSXGBLPOT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |