C16H20BrNO3 — CID 17131713
[3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 17131713) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 17131713 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [3-bromo-4-(oxolan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(OCC2CCCO2)c(Br)c1)N1CCCC1 |
| InChI | InChI=1S/C16H20BrNO3/c17-14-10-12(16(19)18-7-1-2-8-18)5-6-15(14)21-11-13-4-3-9-20-13/h5-6,10,13H,1-4,7-9,11H2 |
| InChIKey | TWBODTGRZFFCJD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |