C15H15F5N2O4S — CID 87540137
(2R)-1-[3,4-dimethoxy-5-(trifluoromethyl)benzenecarbothioyl]-4,4-difluoro-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 87540137) has the molecular formula C15H15F5N2O4S and a molecular weight of 414.35 g/mol. Its IUPAC name is (2R)-1-[3,4-dimethoxy-5-(trifluoromethyl)benzenecarbothioyl]-4,4-difluoro-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[3,4-dimethoxy-5-(trifluoromethyl)benzenecarbothioyl]-4,4-difluoro-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87540137 |
| Molecular Formula | C15H15F5N2O4S |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (2R)-1-[3,4-dimethoxy-5-(trifluoromethyl)benzenecarbothioyl]-4,4-difluoro-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | COc1cc(C(=S)N2CC(F)(F)C[C@@H]2C(=O)NO)cc(C(F)(F)F)c1OC |
| InChI | InChI=1S/C15H15F5N2O4S/c1-25-10-4-7(3-8(11(10)26-2)15(18,19)20)13(27)22-6-14(16,17)5-9(22)12(23)21-24/h3-4,9,24H,5-6H2,1-2H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | BGFBHBWPWOPNEO-SECBINFHSA-N |
| XLogP | 2.61 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|