C11H13F3O3 — CID 117378332
2-[3,4-dimethoxy-5-(trifluoromethyl)phenyl]ethanol (PubChem CID 117378332) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-[3,4-dimethoxy-5-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[3,4-dimethoxy-5-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117378332 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[3,4-dimethoxy-5-(trifluoromethyl)phenyl]ethanol |
| SMILES | COc1cc(CCO)cc(C(F)(F)F)c1OC |
| InChI | InChI=1S/C11H13F3O3/c1-16-9-6-7(3-4-15)5-8(10(9)17-2)11(12,13)14/h5-6,15H,3-4H2,1-2H3 |
| InChIKey | NJZIMJMKJNTNDA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |