C11H16O3 — CID 117286355
2-(3,4-dimethoxy-5-methylphenyl)ethanol (PubChem CID 117286355) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-methylphenyl)ethanol.
| Compound Name | 2-(3,4-dimethoxy-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 117286355 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(3,4-dimethoxy-5-methylphenyl)ethanol |
| SMILES | COc1cc(CCO)cc(C)c1OC |
| InChI | InChI=1S/C11H16O3/c1-8-6-9(4-5-12)7-10(13-2)11(8)14-3/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | PTAZOQVVQRCRFA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |