C27H38O5 — CID 145196302
[3-methoxy-5-methyl-4-(3-methylbut-2-enoxy)phenyl]methanol;2-[4-(3-methylbut-2-enoxy)phenyl]ethanol (PubChem CID 145196302) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is [3-methoxy-5-methyl-4-(3-methylbut-2-enoxy)phenyl]methanol;2-[4-(3-methylbut-2-enoxy)phenyl]ethanol.
| Compound Name | [3-methoxy-5-methyl-4-(3-methylbut-2-enoxy)phenyl]methanol;2-[4-(3-methylbut-2-enoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 145196302 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | [3-methoxy-5-methyl-4-(3-methylbut-2-enoxy)phenyl]methanol;2-[4-(3-methylbut-2-enoxy)phenyl]ethanol |
| SMILES | CC(C)=CCOc1ccc(CCO)cc1.COc1cc(CO)cc(C)c1OCC=C(C)C |
| InChI | InChI=1S/C14H20O3.C13H18O2/c1-10(2)5-6-17-14-11(3)7-12(9-15)8-13(14)16-4;1-11(2)8-10-15-13-5-3-12(4-6-13)7-9-14/h5,7-8,15H,6,9H2,1-4H3;3-6,8,14H,7,9-10H2,1-2H3 |
| InChIKey | MSNCSWNRNFRWOJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|