C14H14F3NO2S — CID 87540108
methyl 1-[3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylate (PubChem CID 87540108) has the molecular formula C14H14F3NO2S and a molecular weight of 317.33 g/mol. Its IUPAC name is methyl 1-[3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87540108 |
| Molecular Formula | C14H14F3NO2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | methyl 1-[3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO2S/c1-20-13(19)11-6-3-7-18(11)12(21)9-4-2-5-10(8-9)14(15,16)17/h2,4-5,8,11H,3,6-7H2,1H3 |
| InChIKey | XMZUYUMQZAABBY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|