C15H19F3N2O4S — CID 87803292
hydroxylamine;(2R)-1-[4-propoxy-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid (PubChem CID 87803292) has the molecular formula C15H19F3N2O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is hydroxylamine;(2R)-1-[4-propoxy-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid.
| Compound Name | hydroxylamine;(2R)-1-[4-propoxy-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87803292 |
| Molecular Formula | C15H19F3N2O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | hydroxylamine;(2R)-1-[4-propoxy-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
| SMILES | CCCOc1ccc(C(=S)N2CC[C@@H]2C(=O)O)cc1C(F)(F)F.NO |
| InChI | InChI=1S/C15H16F3NO3S.H3NO/c1-2-7-22-12-4-3-9(8-10(12)15(16,17)18)13(23)19-6-5-11(19)14(20)21;1-2/h3-4,8,11H,2,5-7H2,1H3,(H,20,21);2H,1H2/t11-;/m1./s1 |
| InChIKey | NDRMQZQVFQVWHT-RFVHGSKJSA-N |
| XLogP | 2.66 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|