C17H20F3NO2S — CID 91605930
(2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid (PubChem CID 91605930) has the molecular formula C17H20F3NO2S and a molecular weight of 359.41 g/mol. Its IUPAC name is (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91605930 |
| Molecular Formula | C17H20F3NO2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
| SMILES | CCCCCc1ccc(C(=S)N2CC[C@@H]2C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO2S/c1-2-3-4-5-11-6-7-12(10-13(11)17(18,19)20)15(24)21-9-8-14(21)16(22)23/h6-7,10,14H,2-5,8-9H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | OVFKWCQEJNBDKM-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|