C20H18F4N2O2S — CID 87540061
(2R)-1-[4-[2-(3-fluorophenyl)ethyl]-3-(trifluoromethyl)benzenecarbothioyl]-N-hydroxyazetidine-2-carboxamide (PubChem CID 87540061) has the molecular formula C20H18F4N2O2S and a molecular weight of 426.44 g/mol. Its IUPAC name is (2R)-1-[4-[2-(3-fluorophenyl)ethyl]-3-(trifluoromethyl)benzenecarbothioyl]-N-hydroxyazetidine-2-carboxamide.
| Compound Name | (2R)-1-[4-[2-(3-fluorophenyl)ethyl]-3-(trifluoromethyl)benzenecarbothioyl]-N-hydroxyazetidine-2-carboxamide |
|---|---|
| PubChem CID | 87540061 |
| Molecular Formula | C20H18F4N2O2S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2R)-1-[4-[2-(3-fluorophenyl)ethyl]-3-(trifluoromethyl)benzenecarbothioyl]-N-hydroxyazetidine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CCN1C(=S)c1ccc(CCc2cccc(F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F4N2O2S/c21-15-3-1-2-12(10-15)4-5-13-6-7-14(11-16(13)20(22,23)24)19(29)26-9-8-17(26)18(27)25-28/h1-3,6-7,10-11,17,28H,4-5,8-9H2,(H,25,27)/t17-/m1/s1 |
| InChIKey | DNUFOQFODNZZFX-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|