C21H22ClNO4S — CID 1127197
[2,6-dimethoxy-4-(piperidine-1-carbothioyl)phenyl] 2-chlorobenzoate (PubChem CID 1127197) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(piperidine-1-carbothioyl)phenyl] 2-chlorobenzoate.
| Compound Name | [2,6-dimethoxy-4-(piperidine-1-carbothioyl)phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 1127197 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2,6-dimethoxy-4-(piperidine-1-carbothioyl)phenyl] 2-chlorobenzoate |
| SMILES | COc1cc(C(=S)N2CCCCC2)cc(OC)c1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClNO4S/c1-25-17-12-14(20(28)23-10-6-3-7-11-23)13-18(26-2)19(17)27-21(24)15-8-4-5-9-16(15)22/h4-5,8-9,12-13H,3,6-7,10-11H2,1-2H3 |
| InChIKey | LCMOGOCRZLTIEN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|