C15H20N2O4S — CID 916631
3,4,5-trimethoxy-N-(pyrrolidine-1-carbothioyl)benzamide (PubChem CID 916631) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(pyrrolidine-1-carbothioyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(pyrrolidine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 916631 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-(pyrrolidine-1-carbothioyl)benzamide |
| SMILES | COc1cc(C(=O)NC(=S)N2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H20N2O4S/c1-19-11-8-10(9-12(20-2)13(11)21-3)14(18)16-15(22)17-6-4-5-7-17/h8-9H,4-7H2,1-3H3,(H,16,18,22) |
| InChIKey | HLNOVBCYTCEULY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|