C15H20N2O6S — CID 18823106
methyl 2-[methyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]acetate (PubChem CID 18823106) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is methyl 2-[methyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]acetate.
| Compound Name | methyl 2-[methyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]acetate |
|---|---|
| PubChem CID | 18823106 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | methyl 2-[methyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]acetate |
| SMILES | COC(=O)CN(C)C(=S)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O6S/c1-17(8-12(18)22-4)15(24)16-14(19)9-6-10(20-2)13(23-5)11(7-9)21-3/h6-7H,8H2,1-5H3,(H,16,19,24) |
| InChIKey | HYIWGGPFVDYBLK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|