C17H26N3O4S+ — CID 7721812
N-(4-ethylpiperazin-4-ium-1-carbothioyl)-3,4,5-trimethoxybenzamide (PubChem CID 7721812) has the molecular formula C17H26N3O4S+ and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(4-ethylpiperazin-4-ium-1-carbothioyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(4-ethylpiperazin-4-ium-1-carbothioyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7721812 |
| Molecular Formula | C17H26N3O4S+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(4-ethylpiperazin-4-ium-1-carbothioyl)-3,4,5-trimethoxybenzamide |
| SMILES | CC[NH+]1CCN(C(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-5-19-6-8-20(9-7-19)17(25)18-16(21)12-10-13(22-2)15(24-4)14(11-12)23-3/h10-11H,5-9H2,1-4H3,(H,18,21,25)/p+1 |
| InChIKey | JCWHVSGGLQXZRA-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|