C15H24ClN3O4 — CID 18531764
3,4,5-trimethoxy-N-(4-methylpiperazin-1-ium-1-yl)benzamide chloride (PubChem CID 18531764) has the molecular formula C15H24ClN3O4 and a molecular weight of 345.83 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(4-methylpiperazin-1-ium-1-yl)benzamide chloride.
| Compound Name | 3,4,5-trimethoxy-N-(4-methylpiperazin-1-ium-1-yl)benzamide chloride |
|---|---|
| PubChem CID | 18531764 |
| Molecular Formula | C15H24ClN3O4 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(4-methylpiperazin-1-ium-1-yl)benzamide chloride |
| SMILES | COc1cc(C(=O)N[NH+]2CCN(C)CC2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C15H23N3O4.ClH/c1-17-5-7-18(8-6-17)16-15(19)11-9-12(20-2)14(22-4)13(10-11)21-3;/h9-10H,5-8H2,1-4H3,(H,16,19);1H |
| InChIKey | FTDCLQAANCABLG-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |