C16H25ClN4O5 — CID 134105342
4-methyl-N'-(3,4,5-trimethoxybenzoyl)piperazine-1-carbohydrazide;hydrochloride (PubChem CID 134105342) has the molecular formula C16H25ClN4O5 and a molecular weight of 388.85 g/mol. Its IUPAC name is 4-methyl-N'-(3,4,5-trimethoxybenzoyl)piperazine-1-carbohydrazide;hydrochloride.
| Compound Name | 4-methyl-N'-(3,4,5-trimethoxybenzoyl)piperazine-1-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 134105342 |
| Molecular Formula | C16H25ClN4O5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-methyl-N'-(3,4,5-trimethoxybenzoyl)piperazine-1-carbohydrazide;hydrochloride |
| SMILES | COc1cc(C(=O)NNC(=O)N2CCN(C)CC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C16H24N4O5.ClH/c1-19-5-7-20(8-6-19)16(22)18-17-15(21)11-9-12(23-2)14(25-4)13(10-11)24-3;/h9-10H,5-8H2,1-4H3,(H,17,21)(H,18,22);1H |
| InChIKey | QSFWIADWXGZXMF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|