C24H30N4O7 — CID 3971478
3,4,5-trimethoxy-N'-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethoxy]acetyl]benzohydrazide (PubChem CID 3971478) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethoxy]acetyl]benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethoxy]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3971478 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3,4,5-trimethoxy-N'-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethoxy]acetyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COCC(=O)N2CCN(c3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N4O7/c1-32-19-13-17(14-20(33-2)23(19)34-3)24(31)26-25-21(29)15-35-16-22(30)28-11-9-27(10-12-28)18-7-5-4-6-8-18/h4-8,13-14H,9-12,15-16H2,1-3H3,(H,25,29)(H,26,31) |
| InChIKey | VZBDBACWRWVIQJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|