C27H35ClN4O6 — CID 3955628
N'-[5-[4-(3-chlorophenyl)piperazin-1-yl]-3,3-dimethyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 3955628) has the molecular formula C27H35ClN4O6 and a molecular weight of 547.05 g/mol. Its IUPAC name is N'-[5-[4-(3-chlorophenyl)piperazin-1-yl]-3,3-dimethyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[5-[4-(3-chlorophenyl)piperazin-1-yl]-3,3-dimethyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 3955628 |
| Molecular Formula | C27H35ClN4O6 |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N'-[5-[4-(3-chlorophenyl)piperazin-1-yl]-3,3-dimethyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CC(C)(C)CC(=O)N2CCN(c3cccc(Cl)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H35ClN4O6/c1-27(2,17-24(34)32-11-9-31(10-12-32)20-8-6-7-19(28)15-20)16-23(33)29-30-26(35)18-13-21(36-3)25(38-5)22(14-18)37-4/h6-8,13-15H,9-12,16-17H2,1-5H3,(H,29,33)(H,30,35) |
| InChIKey | FXCLTOXUARQXRI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|