C24H30FN2O4+ — CID 8684847
(E)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 8684847) has the molecular formula C24H30FN2O4+ and a molecular weight of 429.51 g/mol. Its IUPAC name is (E)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8684847 |
| Molecular Formula | C24H30FN2O4+ |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-1-[4-(4-ethylpiperazin-4-ium-1-yl)-3-fluorophenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CC[NH+]1CCN(c2ccc(C(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)cc2F)CC1 |
| InChI | InChI=1S/C24H29FN2O4/c1-5-26-10-12-27(13-11-26)20-8-7-18(16-19(20)25)21(28)9-6-17-14-22(29-2)24(31-4)23(15-17)30-3/h6-9,14-16H,5,10-13H2,1-4H3/p+1/b9-6+ |
| InChIKey | LXTBQVRIWUNCSE-RMKNXTFCSA-O |
| XLogP | 2.47 |
| TPSA | 52.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|