C14H17IN2O2S — CID 4633502
3-iodo-4-methoxy-N-(piperidine-1-carbothioyl)benzamide (PubChem CID 4633502) has the molecular formula C14H17IN2O2S and a molecular weight of 404.27 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-(piperidine-1-carbothioyl)benzamide.
| Compound Name | 3-iodo-4-methoxy-N-(piperidine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 4633502 |
| Molecular Formula | C14H17IN2O2S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 3-iodo-4-methoxy-N-(piperidine-1-carbothioyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)N2CCCCC2)cc1I |
| InChI | InChI=1S/C14H17IN2O2S/c1-19-12-6-5-10(9-11(12)15)13(18)16-14(20)17-7-3-2-4-8-17/h5-6,9H,2-4,7-8H2,1H3,(H,16,18,20) |
| InChIKey | ILZDOOIQFAJUOC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|