C19H18BrCl2NO2S — CID 3319940
[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-pyrrolidin-1-ylmethanethione (PubChem CID 3319940) has the molecular formula C19H18BrCl2NO2S and a molecular weight of 475.24 g/mol. Its IUPAC name is [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-pyrrolidin-1-ylmethanethione.
| Compound Name | [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-pyrrolidin-1-ylmethanethione |
|---|---|
| PubChem CID | 3319940 |
| Molecular Formula | C19H18BrCl2NO2S |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-pyrrolidin-1-ylmethanethione |
| SMILES | COc1cc(C(=S)N2CCCC2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18BrCl2NO2S/c1-24-17-9-13(19(26)23-6-2-3-7-23)8-15(20)18(17)25-11-12-4-5-14(21)10-16(12)22/h4-5,8-10H,2-3,6-7,11H2,1H3 |
| InChIKey | QTSQLUMEWYLUIC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|