C20H19Br2Cl2NOS — CID 126372128
[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione (PubChem CID 126372128) has the molecular formula C20H19Br2Cl2NOS and a molecular weight of 552.16 g/mol. Its IUPAC name is [3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione.
| Compound Name | [3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
|---|---|
| PubChem CID | 126372128 |
| Molecular Formula | C20H19Br2Cl2NOS |
| Molecular Weight | 552.16 g/mol |
| Exact Mass | 548.89 |
| IUPAC Name | [3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
| SMILES | CC1CCN(C(=S)c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)CC1 |
| InChI | InChI=1S/C20H19Br2Cl2NOS/c1-12-4-6-25(7-5-12)20(27)14-8-16(21)19(17(22)9-14)26-11-13-2-3-15(23)10-18(13)24/h2-3,8-10,12H,4-7,11H2,1H3 |
| InChIKey | BBANNTBAJNOMDK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.16 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|