C21H18BrCl2NO3 — CID 2200346
4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol (PubChem CID 2200346) has the molecular formula C21H18BrCl2NO3 and a molecular weight of 483.19 g/mol. Its IUPAC name is 4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol.
| Compound Name | 4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
|---|---|
| PubChem CID | 2200346 |
| Molecular Formula | C21H18BrCl2NO3 |
| Molecular Weight | 483.19 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
| SMILES | COc1cc(CNc2ccc(O)cc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18BrCl2NO3/c1-27-20-9-13(11-25-16-4-6-17(26)7-5-16)8-18(22)21(20)28-12-14-2-3-15(23)10-19(14)24/h2-10,25-26H,11-12H2,1H3 |
| InChIKey | ZXEMJXKQPAXZPM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.19 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OH_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|