C19H21N5O2S — CID 4996157
4-(5-cyano-2-pyridinyl)-N-(2,5-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 4996157) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 4-(5-cyano-2-pyridinyl)-N-(2,5-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(5-cyano-2-pyridinyl)-N-(2,5-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4996157 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-(5-cyano-2-pyridinyl)-N-(2,5-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(OC)c(NC(=S)N2CCN(c3ccc(C#N)cn3)CC2)c1 |
| InChI | InChI=1S/C19H21N5O2S/c1-25-15-4-5-17(26-2)16(11-15)22-19(27)24-9-7-23(8-10-24)18-6-3-14(12-20)13-21-18/h3-6,11,13H,7-10H2,1-2H3,(H,22,27) |
| InChIKey | MAKDKZAXQSPHQN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|