C21H23N3O2S — CID 3687414
4-cyano-N-(2,5-dimethoxyphenyl)-4-phenylpiperidine-1-carbothioamide (PubChem CID 3687414) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 4-cyano-N-(2,5-dimethoxyphenyl)-4-phenylpiperidine-1-carbothioamide.
| Compound Name | 4-cyano-N-(2,5-dimethoxyphenyl)-4-phenylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3687414 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 4-cyano-N-(2,5-dimethoxyphenyl)-4-phenylpiperidine-1-carbothioamide |
| SMILES | COc1ccc(OC)c(NC(=S)N2CCC(C#N)(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-25-17-8-9-19(26-2)18(14-17)23-20(27)24-12-10-21(15-22,11-13-24)16-6-4-3-5-7-16/h3-9,14H,10-13H2,1-2H3,(H,23,27) |
| InChIKey | CVWFPUPKUIRIKR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|