C20H21N3O — CID 3864975
4-cyano-N-(2-methylphenyl)-4-phenylpiperidine-1-carboxamide (PubChem CID 3864975) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-cyano-N-(2-methylphenyl)-4-phenylpiperidine-1-carboxamide.
| Compound Name | 4-cyano-N-(2-methylphenyl)-4-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 3864975 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-cyano-N-(2-methylphenyl)-4-phenylpiperidine-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1CCC(C#N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O/c1-16-7-5-6-10-18(16)22-19(24)23-13-11-20(15-21,12-14-23)17-8-3-2-4-9-17/h2-10H,11-14H2,1H3,(H,22,24) |
| InChIKey | BFDUTHYPXADART-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |