C19H18IN3O — CID 3717988
4-cyano-N-(3-iodophenyl)-4-phenylpiperidine-1-carboxamide (PubChem CID 3717988) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 4-cyano-N-(3-iodophenyl)-4-phenylpiperidine-1-carboxamide.
| Compound Name | 4-cyano-N-(3-iodophenyl)-4-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 3717988 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 4-cyano-N-(3-iodophenyl)-4-phenylpiperidine-1-carboxamide |
| SMILES | N#CC1(c2ccccc2)CCN(C(=O)Nc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C19H18IN3O/c20-16-7-4-8-17(13-16)22-18(24)23-11-9-19(14-21,10-12-23)15-5-2-1-3-6-15/h1-8,13H,9-12H2,(H,22,24) |
| InChIKey | FJICVELAUAIRRE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|