C26H26N2O6 — CID 3759360
N,1-bis(2,5-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide (PubChem CID 3759360) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is N,1-bis(2,5-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide.
| Compound Name | N,1-bis(2,5-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3759360 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N,1-bis(2,5-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2(c3ccccc3)CC(=O)N2c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-31-18-10-12-22(33-3)20(14-18)27-25(30)26(17-8-6-5-7-9-17)16-24(29)28(26)21-15-19(32-2)11-13-23(21)34-4/h5-15H,16H2,1-4H3,(H,27,30) |
| InChIKey | OOMNDLFXXLIIIS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |