C26H24Cl2N2O6 — CID 4268630
N,1-bis(5-chloro-2,4-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide (PubChem CID 4268630) has the molecular formula C26H24Cl2N2O6 and a molecular weight of 531.39 g/mol. Its IUPAC name is N,1-bis(5-chloro-2,4-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide.
| Compound Name | N,1-bis(5-chloro-2,4-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 4268630 |
| Molecular Formula | C26H24Cl2N2O6 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | N,1-bis(5-chloro-2,4-dimethoxyphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)C2(c3ccccc3)CC(=O)N2c2cc(Cl)c(OC)cc2OC)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N2O6/c1-33-20-12-22(35-3)18(10-16(20)27)29-25(32)26(15-8-6-5-7-9-15)14-24(31)30(26)19-11-17(28)21(34-2)13-23(19)36-4/h5-13H,14H2,1-4H3,(H,29,32) |
| InChIKey | GFGPVZLNUYRWNU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |