C24H22N2O2 — CID 3535232
N,1-bis(2-methylphenyl)-4-oxo-2-phenylazetidine-2-carboxamide (PubChem CID 3535232) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N,1-bis(2-methylphenyl)-4-oxo-2-phenylazetidine-2-carboxamide.
| Compound Name | N,1-bis(2-methylphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3535232 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N,1-bis(2-methylphenyl)-4-oxo-2-phenylazetidine-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1(c2ccccc2)CC(=O)N1c1ccccc1C |
| InChI | InChI=1S/C24H22N2O2/c1-17-10-6-8-14-20(17)25-23(28)24(19-12-4-3-5-13-19)16-22(27)26(24)21-15-9-7-11-18(21)2/h3-15H,16H2,1-2H3,(H,25,28) |
| InChIKey | RBGFFUFAOZGYOH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |