C21H25N3O5 — CID 4585188
methyl 3-[[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 4585188) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is methyl 3-[[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4585188 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 3-[[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2CCN(c3ccc(OC)cc3OC)CC2)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-27-17-7-8-18(19(14-17)28-2)23-9-11-24(12-10-23)21(26)22-16-6-4-5-15(13-16)20(25)29-3/h4-8,13-14H,9-12H2,1-3H3,(H,22,26) |
| InChIKey | POVCMNJVODGZJN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|