C20H22F3N3O3S — CID 3857682
4-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide (PubChem CID 3857682) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3857682 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccc(SC(F)(F)F)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H22F3N3O3S/c1-28-15-5-8-17(18(13-15)29-2)25-9-11-26(12-10-25)19(27)24-14-3-6-16(7-4-14)30-20(21,22)23/h3-8,13H,9-12H2,1-2H3,(H,24,27) |
| InChIKey | YYOXZDWIOAKAAQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|