C22H27Br2N3O3 — CID 3870864
N-(2,6-dibromo-4-propan-2-ylphenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 3870864) has the molecular formula C22H27Br2N3O3 and a molecular weight of 541.28 g/mol. Its IUPAC name is N-(2,6-dibromo-4-propan-2-ylphenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,6-dibromo-4-propan-2-ylphenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3870864 |
| Molecular Formula | C22H27Br2N3O3 |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | N-(2,6-dibromo-4-propan-2-ylphenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3c(Br)cc(C(C)C)cc3Br)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H27Br2N3O3/c1-14(2)15-11-17(23)21(18(24)12-15)25-22(28)27-9-7-26(8-10-27)19-6-5-16(29-3)13-20(19)30-4/h5-6,11-14H,7-10H2,1-4H3,(H,25,28) |
| InChIKey | POBRMUKXXOYMLF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|