C26H29N3O4 — CID 3756709
4-(2,4-dimethoxyphenyl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide (PubChem CID 3756709) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3756709 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccc(OCc4ccccc4)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-31-23-12-13-24(25(18-23)32-2)28-14-16-29(17-15-28)26(30)27-21-8-10-22(11-9-21)33-19-20-6-4-3-5-7-20/h3-13,18H,14-17,19H2,1-2H3,(H,27,30) |
| InChIKey | UUWSMSPNFIIHNR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|